C21H28FIN6 — CID 109407293
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 109407293) has the molecular formula C21H28FIN6 and a molecular weight of 510.40 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109407293 |
| Molecular Formula | C21H28FIN6 |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C21H27FN6.HI/c1-4-23-21(26-14-17-6-5-7-20(27-17)28(2)3)24-11-10-15-13-25-19-9-8-16(22)12-18(15)19;/h5-9,12-13,25H,4,10-11,14H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | GKXKRPQSYZDJED-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|