C23H28FN5O2 — CID 111972446
2-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 111972446) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 111972446 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H28FN5O2/c1-3-25-23(26-11-10-17-14-27-21-9-6-18(24)12-20(17)21)29-15-22(30)28-13-16-4-7-19(31-2)8-5-16/h4-9,12,14,27H,3,10-11,13,15H2,1-2H3,(H,28,30)(H2,25,26,29) |
| InChIKey | SRALGFFMGYMHHE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|