C25H31FIN5O — CID 111973469
N-[3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 111973469) has the molecular formula C25H31FIN5O and a molecular weight of 563.46 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111973469 |
| Molecular Formula | C25H31FIN5O |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | N-[3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C25H30FN5O.HI/c1-2-27-25(28-12-11-19-16-29-23-10-9-20(26)14-22(19)23)30-15-17-5-3-8-21(13-17)31-24(32)18-6-4-7-18;/h3,5,8-10,13-14,16,18,29H,2,4,6-7,11-12,15H2,1H3,(H,31,32)(H2,27,28,30);1H |
| InChIKey | PKQHVQDUAMQKDU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|