C25H31N5O — CID 110997401
N-[3-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 110997401) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[3-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110997401 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | N-[3-[[[N-[2-(1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C25H31N5O/c1-26-25(27-14-13-20-17-28-23-12-5-4-11-22(20)23)29-16-18-7-6-10-21(15-18)30-24(31)19-8-2-3-9-19/h4-7,10-12,15,17,19,28H,2-3,8-9,13-14,16H2,1H3,(H,30,31)(H2,26,27,29) |
| InChIKey | VBVAYEPWMPOSDO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|