C23H28FN5O — CID 111972298
N-[2-[[N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide (PubChem CID 111972298) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 111972298 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-3-methylbenzamide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccc(F)cc12)NCCNC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H28FN5O/c1-3-25-23(28-12-11-26-22(30)17-6-4-5-16(2)13-17)27-10-9-18-15-29-21-8-7-19(24)14-20(18)21/h4-8,13-15,29H,3,9-12H2,1-2H3,(H,26,30)(H2,25,27,28) |
| InChIKey | PLSXMYHZHYUNAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|