C18H14F4N2O — CID 113083594
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 113083594) has the molecular formula C18H14F4N2O and a molecular weight of 350.32 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113083594 |
| Molecular Formula | C18H14F4N2O |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(F)cc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F4N2O/c19-14-5-6-16-15(9-14)12(10-24-16)7-8-23-17(25)11-1-3-13(4-2-11)18(20,21)22/h1-6,9-10,24H,7-8H2,(H,23,25) |
| InChIKey | LQWYQSJSFLQPSA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |