C12H13FN2O2 — CID 110731487
methyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate (PubChem CID 110731487) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is methyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | methyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 110731487 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C12H13FN2O2/c1-17-12(16)14-5-4-8-7-15-11-3-2-9(13)6-10(8)11/h2-3,6-7,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | QLEWXCOSTVNHEF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |