C19H19FN2O2 — CID 110731485
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(4-methylphenoxy)acetamide (PubChem CID 110731485) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 110731485 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCCc2c[nH]c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C19H19FN2O2/c1-13-2-5-16(6-3-13)24-12-19(23)21-9-8-14-11-22-18-7-4-15(20)10-17(14)18/h2-7,10-11,22H,8-9,12H2,1H3,(H,21,23) |
| InChIKey | GMKHTKMOGGKRCD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |