C17H15FN2O2 — CID 69217510
phenyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate (PubChem CID 69217510) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is phenyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | phenyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 69217510 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | phenyl N-[2-(5-fluoro-1H-indol-3-yl)ethyl]carbamate |
| SMILES | O=C(NCCc1c[nH]c2ccc(F)cc12)Oc1ccccc1 |
| InChI | InChI=1S/C17H15FN2O2/c18-13-6-7-16-15(10-13)12(11-20-16)8-9-19-17(21)22-14-4-2-1-3-5-14/h1-7,10-11,20H,8-9H2,(H,19,21) |
| InChIKey | JVDXKYXGZQTXNM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |