C17H24FN3O2 — CID 67394852
tert-butyl N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]ethyl]carbamate (PubChem CID 67394852) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 67394852 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C17H24FN3O2/c1-17(2,3)23-16(22)20-9-8-19-7-6-12-11-21-15-5-4-13(18)10-14(12)15/h4-5,10-11,19,21H,6-9H2,1-3H3,(H,20,22) |
| InChIKey | FHBNGZQBXNOESF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|