C19H26N2O5 — CID 177224791
4-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-5-yl]oxy]butanoic acid (PubChem CID 177224791) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-5-yl]oxy]butanoic acid.
| Compound Name | 4-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-5-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 177224791 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-5-yl]oxy]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(OCCCC(=O)O)cc12 |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,3)26-18(24)20-9-8-13-12-21-16-7-6-14(11-15(13)16)25-10-4-5-17(22)23/h6-7,11-12,21H,4-5,8-10H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | QGFQCCBHDJRJAE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|