C28H28N2O3 — CID 70053183
tert-butyl N-[2-[5-(4-benzoylphenyl)-1H-indol-3-yl]ethyl]carbamate (PubChem CID 70053183) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(4-benzoylphenyl)-1H-indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(4-benzoylphenyl)-1H-indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70053183 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | tert-butyl N-[2-[5-(4-benzoylphenyl)-1H-indol-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(-c3ccc(C(=O)c4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C28H28N2O3/c1-28(2,3)33-27(32)29-16-15-23-18-30-25-14-13-22(17-24(23)25)19-9-11-21(12-10-19)26(31)20-7-5-4-6-8-20/h4-14,17-18,30H,15-16H2,1-3H3,(H,29,32) |
| InChIKey | GHXYAMIYQHSDLZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |