C22H17NO2 — CID 131953217
2-[5-(4-phenylphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 131953217) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[5-(4-phenylphenyl)-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[5-(4-phenylphenyl)-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 131953217 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[5-(4-phenylphenyl)-1H-indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c[nH]c2ccc(-c3ccc(-c4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C22H17NO2/c24-22(25)13-19-14-23-21-11-10-18(12-20(19)21)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-12,14,23H,13H2,(H,24,25) |
| InChIKey | CBAIPGGFZGBBDF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |