2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid

C18H17NO2 — CID 95483214

IUPAC2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid
SMILESCc1cc(C)cc(-c2ccc3[nH]cc(CC(=O)O)c3c2)c1
InChIInChI=1S/C18H17NO2/c1-11-5-12(2)7-14(6-11)13-3-4-17-16(8-13)15(10-19-17)9-18(20)21/h3-8,10,19H,9H2,1-2H3,(H,20,21)
InChIKeyFHILFZHFCCKMRF-UHFFFAOYSA-N
MW279.34 g/mol
LogP4.08
Rot. Bonds3

About 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid

2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid (PubChem CID 95483214) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid
PubChem CID95483214
Molecular FormulaC18H17NO2
Molecular Weight279.34 g/mol
Exact Mass279.13
IUPAC Name2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid
SMILESCc1cc(C)cc(-c2ccc3[nH]cc(CC(=O)O)c3c2)c1
InChIInChI=1S/C18H17NO2/c1-11-5-12(2)7-14(6-11)13-3-4-17-16(8-13)15(10-19-17)9-18(20)21/h3-8,10,19H,9H2,1-2H3,(H,20,21)
InChIKeyFHILFZHFCCKMRF-UHFFFAOYSA-N
XLogP4.08
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 54.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid?
The IUPAC name of 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid (CID 95483214) is 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid is Cc1cc(C)cc(-c2ccc3[nH]cc(CC(=O)O)c3c2)c1.
What is the InChIKey of 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid?
The InChIKey is FHILFZHFCCKMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-11-5-12(2)7-14(6-11)13-3-4-17-16(8-13)15(10-19-17)9-18(20)21/h3-8,10,19H,9H2,1-2H3,(H,20,21).
What are the key properties of 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid?
2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid has a molecular weight of 279.34 g/mol, XLogP of 4.08, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,5-dimethylphenyl)-1H-indol-3-yl]acetic acid is sourced from PubChem (CID 95483214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).