methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate

C19H19NO2 — CID 166042268

IUPACmethyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate
SMILESCOC(=O)Cc1c[nH]c2ccc(-c3ccc(C)c(C)c3)cc12
InChIInChI=1S/C19H19NO2/c1-12-4-5-14(8-13(12)2)15-6-7-18-17(9-15)16(11-20-18)10-19(21)22-3/h4-9,11,20H,10H2,1-3H3
InChIKeySLWPKRPZQFIQFQ-UHFFFAOYSA-N
MW293.37 g/mol
LogP4.17
Rot. Bonds3

About methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate

methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate (PubChem CID 166042268) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate
PubChem CID166042268
Molecular FormulaC19H19NO2
Molecular Weight293.37 g/mol
Exact Mass293.14
IUPAC Namemethyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate
SMILESCOC(=O)Cc1c[nH]c2ccc(-c3ccc(C)c(C)c3)cc12
InChIInChI=1S/C19H19NO2/c1-12-4-5-14(8-13(12)2)15-6-7-18-17(9-15)16(11-20-18)10-19(21)22-3/h4-9,11,20H,10H2,1-3H3
InChIKeySLWPKRPZQFIQFQ-UHFFFAOYSA-N
XLogP4.17
TPSA42.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.37
LogP ≤ 54.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate?
The IUPAC name of methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate (CID 166042268) is methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate.
What is the SMILES notation for methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate?
The canonical SMILES for methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate is COC(=O)Cc1c[nH]c2ccc(-c3ccc(C)c(C)c3)cc12.
What is the InChIKey of methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate?
The InChIKey is SLWPKRPZQFIQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-12-4-5-14(8-13(12)2)15-6-7-18-17(9-15)16(11-20-18)10-19(21)22-3/h4-9,11,20H,10H2,1-3H3.
What are the key properties of methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate?
methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate has a molecular weight of 293.37 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(3,4-dimethylphenyl)-1H-indol-3-yl]acetate is sourced from PubChem (CID 166042268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).