C29H36N2O6 — CID 158449887
2-(5-butoxy-1H-indol-3-yl)acetic acid;methyl 2-(5-butoxy-1H-indol-3-yl)acetate (PubChem CID 158449887) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-(5-butoxy-1H-indol-3-yl)acetic acid;methyl 2-(5-butoxy-1H-indol-3-yl)acetate.
| Compound Name | 2-(5-butoxy-1H-indol-3-yl)acetic acid;methyl 2-(5-butoxy-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 158449887 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-(5-butoxy-1H-indol-3-yl)acetic acid;methyl 2-(5-butoxy-1H-indol-3-yl)acetate |
| SMILES | CCCCOc1ccc2[nH]cc(CC(=O)O)c2c1.CCCCOc1ccc2[nH]cc(CC(=O)OC)c2c1 |
| InChI | InChI=1S/C15H19NO3.C14H17NO3/c1-3-4-7-19-12-5-6-14-13(9-12)11(10-16-14)8-15(17)18-2;1-2-3-6-18-11-4-5-13-12(8-11)10(9-15-13)7-14(16)17/h5-6,9-10,16H,3-4,7-8H2,1-2H3;4-5,8-9,15H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | HDVRUIVSFMCTOE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|