C28H29NO5 — CID 51038992
methyl 2-[5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetate (PubChem CID 51038992) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is methyl 2-[5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetate.
| Compound Name | methyl 2-[5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 51038992 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | methyl 2-[5-[3-[3-[(4-methylphenyl)methoxy]phenoxy]propoxy]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c[nH]c2ccc(OCCCOc3cccc(OCc4ccc(C)cc4)c3)cc12 |
| InChI | InChI=1S/C28H29NO5/c1-20-7-9-21(10-8-20)19-34-24-6-3-5-23(16-24)32-13-4-14-33-25-11-12-27-26(17-25)22(18-29-27)15-28(30)31-2/h3,5-12,16-18,29H,4,13-15,19H2,1-2H3 |
| InChIKey | CEWLVKQXXQADHJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|