C20H22N2O5 — CID 142512839
ethyl 2-(5-phenylmethoxy-1H-indol-3-yl)acetate;nitromethane (PubChem CID 142512839) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 2-(5-phenylmethoxy-1H-indol-3-yl)acetate;nitromethane.
| Compound Name | ethyl 2-(5-phenylmethoxy-1H-indol-3-yl)acetate;nitromethane |
|---|---|
| PubChem CID | 142512839 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | ethyl 2-(5-phenylmethoxy-1H-indol-3-yl)acetate;nitromethane |
| SMILES | CCOC(=O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12.C[N+](=O)[O-] |
| InChI | InChI=1S/C19H19NO3.CH3NO2/c1-2-22-19(21)10-15-12-20-18-9-8-16(11-17(15)18)23-13-14-6-4-3-5-7-14;1-2(3)4/h3-9,11-12,20H,2,10,13H2,1H3;1H3 |
| InChIKey | UPLOZTAYTNKNAX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|