C20H22N2O5 — CID 25021298
N-methyl-2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;oxalic acid (PubChem CID 25021298) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-methyl-2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;oxalic acid.
| Compound Name | N-methyl-2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 25021298 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-methyl-2-(5-phenylmethoxy-1H-indol-3-yl)ethanamine;oxalic acid |
| SMILES | CNCCc1c[nH]c2ccc(OCc3ccccc3)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H20N2O.C2H2O4/c1-19-10-9-15-12-20-18-8-7-16(11-17(15)18)21-13-14-5-3-2-4-6-14;3-1(4)2(5)6/h2-8,11-12,19-20H,9-10,13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YBAUEULZSLJRIJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|