C17H21N2O5P — CID 139051934
dihydrogen phosphate;2-(5-phenylmethoxy-1H-indol-3-yl)ethylazanium (PubChem CID 139051934) has the molecular formula C17H21N2O5P and a molecular weight of 364.34 g/mol. Its IUPAC name is dihydrogen phosphate;2-(5-phenylmethoxy-1H-indol-3-yl)ethylazanium.
| Compound Name | dihydrogen phosphate;2-(5-phenylmethoxy-1H-indol-3-yl)ethylazanium |
|---|---|
| PubChem CID | 139051934 |
| Molecular Formula | C17H21N2O5P |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | dihydrogen phosphate;2-(5-phenylmethoxy-1H-indol-3-yl)ethylazanium |
| SMILES | O=P([O-])(O)O.[NH3+]CCc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C17H18N2O.H3O4P/c18-9-8-14-11-19-17-7-6-15(10-16(14)17)20-12-13-4-2-1-3-5-13;1-5(2,3)4/h1-7,10-11,19H,8-9,12,18H2;(H3,1,2,3,4) |
| InChIKey | CAMACRSWCSNRFM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|