C25H21N3O6 — CID 3545531
2-nitro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylcarbamoyl]benzoic acid (PubChem CID 3545531) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-nitro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylcarbamoyl]benzoic acid.
| Compound Name | 2-nitro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3545531 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-nitro-6-[2-(5-phenylmethoxy-1H-indol-3-yl)ethylcarbamoyl]benzoic acid |
| SMILES | O=C(NCCc1c[nH]c2ccc(OCc3ccccc3)cc12)c1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C25H21N3O6/c29-24(19-7-4-8-22(28(32)33)23(19)25(30)31)26-12-11-17-14-27-21-10-9-18(13-20(17)21)34-15-16-5-2-1-3-6-16/h1-10,13-14,27H,11-12,15H2,(H,26,29)(H,30,31) |
| InChIKey | SYUKEJFHUAREDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|