C18H18N2O6S — CID 71313888
benzyl N-[2-(5-sulfooxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 71313888) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is benzyl N-[2-(5-sulfooxy-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-(5-sulfooxy-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 71313888 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | benzyl N-[2-(5-sulfooxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | O=C(NCCc1c[nH]c2ccc(OS(=O)(=O)O)cc12)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N2O6S/c21-18(25-12-13-4-2-1-3-5-13)19-9-8-14-11-20-17-7-6-15(10-16(14)17)26-27(22,23)24/h1-7,10-11,20H,8-9,12H2,(H,19,21)(H,22,23,24) |
| InChIKey | MESFHYWARXPWKX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|