C20H21ClN2O3 — CID 6733787
2-(3-chlorophenyl)ethyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 6733787) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | 2-(3-chlorophenyl)ethyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 6733787 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(3-chlorophenyl)ethyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)OCCc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-25-17-5-6-19-18(12-17)15(13-23-19)7-9-22-20(24)26-10-8-14-3-2-4-16(21)11-14/h2-6,11-13,23H,7-10H2,1H3,(H,22,24) |
| InChIKey | UFSFAWOXCJFFGW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |