C16H19ClN2O3 — CID 45109027
[(Z)-3-chlorobut-2-enyl] N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 45109027) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is [(Z)-3-chlorobut-2-enyl] N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | [(Z)-3-chlorobut-2-enyl] N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 45109027 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(Z)-3-chlorobut-2-enyl] N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)OC/C=C(/C)Cl)c2c1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-11(17)6-8-22-16(20)18-7-5-12-10-19-15-4-3-13(21-2)9-14(12)15/h3-4,6,9-10,19H,5,7-8H2,1-2H3,(H,18,20)/b11-6- |
| InChIKey | DONCTTJXKKOQIF-WDZFZDKYSA-N |
| XLogP | 3.59 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |