C16H20FN3O4 — CID 172894834
3-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]azetidine-3-carboxamide;formic acid (PubChem CID 172894834) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]azetidine-3-carboxamide;formic acid.
| Compound Name | 3-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]azetidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 172894834 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-fluoro-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]azetidine-3-carboxamide;formic acid |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)C3(F)CNC3)c2c1.O=CO |
| InChI | InChI=1S/C15H18FN3O2.CH2O2/c1-21-11-2-3-13-12(6-11)10(7-19-13)4-5-18-14(20)15(16)8-17-9-15;2-1-3/h2-3,6-7,17,19H,4-5,8-9H2,1H3,(H,18,20);1H,(H,2,3) |
| InChIKey | GQFIGQRQNUJZNQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|