C26H26ClN3O2 — CID 129111066
4-[(3-chloro-N-methylanilino)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide (PubChem CID 129111066) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-[(3-chloro-N-methylanilino)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 4-[(3-chloro-N-methylanilino)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 129111066 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[(3-chloro-N-methylanilino)methyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)c3ccc(CN(C)c4cccc(Cl)c4)cc3)c2c1 |
| InChI | InChI=1S/C26H26ClN3O2/c1-30(22-5-3-4-21(27)14-22)17-18-6-8-19(9-7-18)26(31)28-13-12-20-16-29-25-11-10-23(32-2)15-24(20)25/h3-11,14-16,29H,12-13,17H2,1-2H3,(H,28,31) |
| InChIKey | OHBMEYAJAZVVRH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |