C19H20N2O3 — CID 6734996
(3-methylphenyl)methyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 6734996) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (3-methylphenyl)methyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | (3-methylphenyl)methyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 6734996 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3-methylphenyl)methyl N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1cccc(COC(=O)NCCc2c[nH]c3ccc(O)cc23)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-13-3-2-4-14(9-13)12-24-19(23)20-8-7-15-11-21-18-6-5-16(22)10-17(15)18/h2-6,9-11,21-22H,7-8,12H2,1H3,(H,20,23) |
| InChIKey | KYDDKIYFAQYFRY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |