C17H17N3O2 — CID 24801935
2-(5-phenylmethoxy-1H-indol-3-yl)acetohydrazide (PubChem CID 24801935) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(5-phenylmethoxy-1H-indol-3-yl)acetohydrazide.
| Compound Name | 2-(5-phenylmethoxy-1H-indol-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 24801935 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(5-phenylmethoxy-1H-indol-3-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C17H17N3O2/c18-20-17(21)8-13-10-19-16-7-6-14(9-15(13)16)22-11-12-4-2-1-3-5-12/h1-7,9-10,19H,8,11,18H2,(H,20,21) |
| InChIKey | NPXZEKUDZRRTQB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|