C21H21NO3 — CID 19372353
ethyl (E)-4-(5-phenylmethoxy-1H-indol-3-yl)but-2-enoate (PubChem CID 19372353) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl (E)-4-(5-phenylmethoxy-1H-indol-3-yl)but-2-enoate.
| Compound Name | ethyl (E)-4-(5-phenylmethoxy-1H-indol-3-yl)but-2-enoate |
|---|---|
| PubChem CID | 19372353 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl (E)-4-(5-phenylmethoxy-1H-indol-3-yl)but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C21H21NO3/c1-2-24-21(23)10-6-9-17-14-22-20-12-11-18(13-19(17)20)25-15-16-7-4-3-5-8-16/h3-8,10-14,22H,2,9,15H2,1H3/b10-6+ |
| InChIKey | CYLFMVFVSPEJRN-UXBLZVDNSA-N |
| XLogP | 4.41 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|