C23H26N2O5 — CID 11502438
diethyl 2-amino-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanedioate (PubChem CID 11502438) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is diethyl 2-amino-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanedioate.
| Compound Name | diethyl 2-amino-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 11502438 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | diethyl 2-amino-2-[(5-phenylmethoxy-1H-indol-3-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(N)(Cc1c[nH]c2ccc(OCc3ccccc3)cc12)C(=O)OCC |
| InChI | InChI=1S/C23H26N2O5/c1-3-28-21(26)23(24,22(27)29-4-2)13-17-14-25-20-11-10-18(12-19(17)20)30-15-16-8-6-5-7-9-16/h5-12,14,25H,3-4,13,15,24H2,1-2H3 |
| InChIKey | IOBIESMYORQRRW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|