C16H20N2O4 — CID 14315603
diethyl 2-amino-2-(1H-indol-3-ylmethyl)propanedioate (PubChem CID 14315603) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is diethyl 2-amino-2-(1H-indol-3-ylmethyl)propanedioate.
| Compound Name | diethyl 2-amino-2-(1H-indol-3-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 14315603 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | diethyl 2-amino-2-(1H-indol-3-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(N)(Cc1c[nH]c2ccccc12)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O4/c1-3-21-14(19)16(17,15(20)22-4-2)9-11-10-18-13-8-6-5-7-12(11)13/h5-8,10,18H,3-4,9,17H2,1-2H3 |
| InChIKey | KANUWVRMUOALHB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|