C13H16N2O2 — CID 57296369
methyl (2S)-2-amino-2-(deuteriomethyl)-3-(1H-indol-3-yl)propanoate (PubChem CID 57296369) has the molecular formula C13H16N2O2 and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(deuteriomethyl)-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-amino-2-(deuteriomethyl)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 57296369 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methyl (2S)-2-amino-2-(deuteriomethyl)-3-(1H-indol-3-yl)propanoate |
| SMILES | [2H]C[C@](N)(Cc1c[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C13H16N2O2/c1-13(14,12(16)17-2)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,8,15H,7,14H2,1-2H3/t13-/m0/s1/i1D |
| InChIKey | RCUNGDZWHFRBBP-VBVYNBRASA-N |
| XLogP | 1.60 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |