C13H16N2O2 — CID 14066612
methyl (2S)-2-amino-3-(1H-indol-3-yl)-2-(111C)methylpropanoate (PubChem CID 14066612) has the molecular formula C13H16N2O2 and a molecular weight of 231.28 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(1H-indol-3-yl)-2-(111C)methylpropanoate.
| Compound Name | methyl (2S)-2-amino-3-(1H-indol-3-yl)-2-(111C)methylpropanoate |
|---|---|
| PubChem CID | 14066612 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | methyl (2S)-2-amino-3-(1H-indol-3-yl)-2-(111C)methylpropanoate |
| SMILES | COC(=O)[C@@]([11CH3])(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H16N2O2/c1-13(14,12(16)17-2)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,8,15H,7,14H2,1-2H3/t13-/m0/s1/i1-1 |
| InChIKey | RCUNGDZWHFRBBP-XOTOJZTHSA-N |
| XLogP | 1.60 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |