C22H29N3O — CID 22417241
N-(2-adamantyl)-2-amino-3-(1H-indol-3-yl)-2-methylpropanamide (PubChem CID 22417241) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-(2-adamantyl)-2-amino-3-(1H-indol-3-yl)-2-methylpropanamide.
| Compound Name | N-(2-adamantyl)-2-amino-3-(1H-indol-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 22417241 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-(2-adamantyl)-2-amino-3-(1H-indol-3-yl)-2-methylpropanamide |
| SMILES | CC(N)(Cc1c[nH]c2ccccc12)C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H29N3O/c1-22(23,11-17-12-24-19-5-3-2-4-18(17)19)21(26)25-20-15-7-13-6-14(9-15)10-16(20)8-13/h2-5,12-16,20,24H,6-11,23H2,1H3,(H,25,26) |
| InChIKey | MXJPSPNCDGNEKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |