C16H21N3O3 — CID 67671736
4-[[(2S)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]butanoic acid (PubChem CID 67671736) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]butanoic acid.
| Compound Name | 4-[[(2S)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67671736 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[[(2S)-2-amino-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]butanoic acid |
| SMILES | C[C@](N)(Cc1c[nH]c2ccccc12)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C16H21N3O3/c1-16(17,15(22)18-8-4-7-14(20)21)9-11-10-19-13-6-3-2-5-12(11)13/h2-3,5-6,10,19H,4,7-9,17H2,1H3,(H,18,22)(H,20,21)/t16-/m0/s1 |
| InChIKey | NOKNZBDHLUHGII-INIZCTEOSA-N |
| XLogP | 1.41 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|