C22H26N2O — CID 54112601
2-(1H-indol-3-ylmethyl)-2-methyl-N-(2-phenylethyl)butanamide (PubChem CID 54112601) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-2-methyl-N-(2-phenylethyl)butanamide.
| Compound Name | 2-(1H-indol-3-ylmethyl)-2-methyl-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 54112601 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-2-methyl-N-(2-phenylethyl)butanamide |
| SMILES | CCC(C)(Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O/c1-3-22(2,15-18-16-24-20-12-8-7-11-19(18)20)21(25)23-14-13-17-9-5-4-6-10-17/h4-12,16,24H,3,13-15H2,1-2H3,(H,23,25) |
| InChIKey | DWDCNHFWFIWSIY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |