C23H27N3O2 — CID 108961978
N-[2-(1H-indol-3-yl)ethyl]-2,2-dimethyl-N'-[(4-methylphenyl)methyl]propanediamide (PubChem CID 108961978) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2,2-dimethyl-N'-[(4-methylphenyl)methyl]propanediamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2,2-dimethyl-N'-[(4-methylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108961978 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2,2-dimethyl-N'-[(4-methylphenyl)methyl]propanediamide |
| SMILES | Cc1ccc(CNC(=O)C(C)(C)C(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-8-10-17(11-9-16)14-26-22(28)23(2,3)21(27)24-13-12-18-15-25-20-7-5-4-6-19(18)20/h4-11,15,25H,12-14H2,1-3H3,(H,24,27)(H,26,28) |
| InChIKey | NTBDTOAKOMJGGM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|