C21H24N2O — CID 23356005
3-(1H-indol-3-yl)-2,2-dimethyl-N-(2-phenylethyl)propanamide (PubChem CID 23356005) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2,2-dimethyl-N-(2-phenylethyl)propanamide.
| Compound Name | 3-(1H-indol-3-yl)-2,2-dimethyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 23356005 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 3-(1H-indol-3-yl)-2,2-dimethyl-N-(2-phenylethyl)propanamide |
| SMILES | CC(C)(Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c1-21(2,14-17-15-23-19-11-7-6-10-18(17)19)20(24)22-13-12-16-8-4-3-5-9-16/h3-11,15,23H,12-14H2,1-2H3,(H,22,24) |
| InChIKey | PTAZYIHTOAEFPM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |