C19H21N3O4 — CID 19047782
[1-[2-(furan-2-yl)ethylamino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 19047782) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [1-[2-(furan-2-yl)ethylamino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[2-(furan-2-yl)ethylamino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 19047782 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [1-[2-(furan-2-yl)ethylamino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(Cc1c[nH]c2ccccc12)(NC(=O)O)C(=O)NCCc1ccco1 |
| InChI | InChI=1S/C19H21N3O4/c1-19(22-18(24)25,17(23)20-9-8-14-5-4-10-26-14)11-13-12-21-16-7-3-2-6-15(13)16/h2-7,10,12,21-22H,8-9,11H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | YULQABOFBKLIBL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |