C31H39N3O3 — CID 10074744
[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate (PubChem CID 10074744) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate.
| Compound Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 10074744 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-(2-phenylethylamino)propan-2-yl]carbamate |
| SMILES | C[C@@H]1[C@@H](OC(=O)NC(C)(Cc2c[nH]c3ccccc23)C(=O)NCCc2ccccc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C31H39N3O3/c1-20-25-16-23(30(25,2)3)17-27(20)37-29(36)34-31(4,18-22-19-33-26-13-9-8-12-24(22)26)28(35)32-15-14-21-10-6-5-7-11-21/h5-13,19-20,23,25,27,33H,14-18H2,1-4H3,(H,32,35)(H,34,36)/t20-,23+,25-,27-,31?/m0/s1 |
| InChIKey | XHGFSOGHGIZBEL-BQBXBGBDSA-N |
| XLogP | 5.62 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |