C20H26N2O4 — CID 10428483
(2R)-3-(1H-indol-3-yl)-2-methyl-2-[(2-methylcyclohexyl)oxycarbonylamino]propanoic acid (PubChem CID 10428483) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-2-methyl-2-[(2-methylcyclohexyl)oxycarbonylamino]propanoic acid.
| Compound Name | (2R)-3-(1H-indol-3-yl)-2-methyl-2-[(2-methylcyclohexyl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 10428483 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-2-methyl-2-[(2-methylcyclohexyl)oxycarbonylamino]propanoic acid |
| SMILES | CC1CCCCC1OC(=O)N[C@](C)(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H26N2O4/c1-13-7-3-6-10-17(13)26-19(25)22-20(2,18(23)24)11-14-12-21-16-9-5-4-8-15(14)16/h4-5,8-9,12-13,17,21H,3,6-7,10-11H2,1-2H3,(H,22,25)(H,23,24)/t13?,17?,20-/m1/s1 |
| InChIKey | UHIPIRRHRZYPJW-RJGDCVCESA-N |
| XLogP | 3.86 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |