C17H19Cl3N2O4 — CID 22838884
(2S)-3-(1H-indol-3-yl)-2-methyl-2-(4,4,4-trichlorobutoxycarbonylamino)propanoic acid (PubChem CID 22838884) has the molecular formula C17H19Cl3N2O4 and a molecular weight of 421.71 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-methyl-2-(4,4,4-trichlorobutoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-methyl-2-(4,4,4-trichlorobutoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 22838884 |
| Molecular Formula | C17H19Cl3N2O4 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-methyl-2-(4,4,4-trichlorobutoxycarbonylamino)propanoic acid |
| SMILES | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)OCCCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C17H19Cl3N2O4/c1-16(14(23)24,22-15(25)26-8-4-7-17(18,19)20)9-11-10-21-13-6-3-2-5-12(11)13/h2-3,5-6,10,21H,4,7-9H2,1H3,(H,22,25)(H,23,24)/t16-/m0/s1 |
| InChIKey | XKOLTXQFBUBGOY-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|