C13H12Cl3NO2 — CID 15174890
3-(1H-indol-3-yl)propyl 2,2,2-trichloroacetate (PubChem CID 15174890) has the molecular formula C13H12Cl3NO2 and a molecular weight of 320.60 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)propyl 2,2,2-trichloroacetate.
| Compound Name | 3-(1H-indol-3-yl)propyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 15174890 |
| Molecular Formula | C13H12Cl3NO2 |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-(1H-indol-3-yl)propyl 2,2,2-trichloroacetate |
| SMILES | O=C(OCCCc1c[nH]c2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H12Cl3NO2/c14-13(15,16)12(18)19-7-3-4-9-8-17-11-6-2-1-5-10(9)11/h1-2,5-6,8,17H,3-4,7H2 |
| InChIKey | HHXWGJHQHSPSTE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|