C11H14NO4P — CID 3713
3-(1H-indol-3-yl)propyl dihydrogen phosphate (PubChem CID 3713) has the molecular formula C11H14NO4P and a molecular weight of 255.21 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)propyl dihydrogen phosphate.
| Compound Name | 3-(1H-indol-3-yl)propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 3713 |
| Molecular Formula | C11H14NO4P |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(1H-indol-3-yl)propyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H14NO4P/c13-17(14,15)16-7-3-4-9-8-12-11-6-2-1-5-10(9)11/h1-2,5-6,8,12H,3-4,7H2,(H2,13,14,15) |
| InChIKey | NKEZSFZOUIIZFL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|