C17H21FN2O4 — CID 68722431
2-(butoxycarbonylamino)-3-(6-fluoro-1H-indol-3-yl)-2-methylpropanoic acid (PubChem CID 68722431) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-3-(6-fluoro-1H-indol-3-yl)-2-methylpropanoic acid.
| Compound Name | 2-(butoxycarbonylamino)-3-(6-fluoro-1H-indol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68722431 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(butoxycarbonylamino)-3-(6-fluoro-1H-indol-3-yl)-2-methylpropanoic acid |
| SMILES | CCCCOC(=O)NC(C)(Cc1c[nH]c2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C17H21FN2O4/c1-3-4-7-24-16(23)20-17(2,15(21)22)9-11-10-19-14-8-12(18)5-6-13(11)14/h5-6,8,10,19H,3-4,7,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | QWUUHRBNJQMCFY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|