C20H24N2O2 — CID 174391418
benzene;2-(dimethylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid (PubChem CID 174391418) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is benzene;2-(dimethylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid.
| Compound Name | benzene;2-(dimethylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 174391418 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | benzene;2-(dimethylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid |
| SMILES | CN(C)C(C)(Cc1c[nH]c2ccccc12)C(=O)O.c1ccccc1 |
| InChI | InChI=1S/C14H18N2O2.C6H6/c1-14(13(17)18,16(2)3)8-10-9-15-12-7-5-4-6-11(10)12;1-2-4-6-5-3-1/h4-7,9,15H,8H2,1-3H3,(H,17,18);1-6H |
| InChIKey | LEKWQBVNXXWTAH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |