C15H15NO5 — CID 59215234
2-hydroxy-2-(1H-indol-3-ylmethyl)-4,5-dioxohexanoic acid (PubChem CID 59215234) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-hydroxy-2-(1H-indol-3-ylmethyl)-4,5-dioxohexanoic acid.
| Compound Name | 2-hydroxy-2-(1H-indol-3-ylmethyl)-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 59215234 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-hydroxy-2-(1H-indol-3-ylmethyl)-4,5-dioxohexanoic acid |
| SMILES | CC(=O)C(=O)CC(O)(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H15NO5/c1-9(17)13(18)7-15(21,14(19)20)6-10-8-16-12-5-3-2-4-11(10)12/h2-5,8,16,21H,6-7H2,1H3,(H,19,20) |
| InChIKey | FGIKUKGQHALKAK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|