C14H12N2Na2O6 — CID 102484724
disodium;(2R,4E)-2,5-dihydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate (PubChem CID 102484724) has the molecular formula C14H12N2Na2O6 and a molecular weight of 350.24 g/mol. Its IUPAC name is disodium;(2R,4E)-2,5-dihydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate.
| Compound Name | disodium;(2R,4E)-2,5-dihydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate |
|---|---|
| PubChem CID | 102484724 |
| Molecular Formula | C14H12N2Na2O6 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | disodium;(2R,4E)-2,5-dihydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate |
| SMILES | O=C(O)/C(C[C@](O)(Cc1c[nH]c2ccccc12)C(=O)[O-])=N/[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H14N2O6.2Na/c17-12(18)11(16-22)6-14(21,13(19)20)5-8-7-15-10-4-2-1-3-9(8)10;;/h1-4,7,15,21-22H,5-6H2,(H,17,18)(H,19,20);;/q;2*+1/p-2/b16-11+;;/t14-;;/m1../s1 |
| InChIKey | GIUKICVFOBDFDR-VVHUBMMXSA-L |
| XLogP | -6.39 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|