C14H20N4O5 — CID 141071157
diazanium;5-hydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate (PubChem CID 141071157) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is diazanium;5-hydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate.
| Compound Name | diazanium;5-hydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate |
|---|---|
| PubChem CID | 141071157 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | diazanium;5-hydroxy-2-(1H-indol-3-ylmethyl)-4-oxidoimino-5-oxopentanoate |
| SMILES | O=C(O)C(CC(Cc1c[nH]c2ccccc12)C(=O)[O-])=N[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C14H14N2O5.2H3N/c17-13(18)8(6-12(16-21)14(19)20)5-9-7-15-11-4-2-1-3-10(9)11;;/h1-4,7-8,15,21H,5-6H2,(H,17,18)(H,19,20);2*1H3 |
| InChIKey | BCKKJFWCCCLLMA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|