C30H24N2O3 — CID 71514449
(2E)-3-(1H-indol-3-yl)-2-trityloxyiminopropanoic acid (PubChem CID 71514449) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is (2E)-3-(1H-indol-3-yl)-2-trityloxyiminopropanoic acid.
| Compound Name | (2E)-3-(1H-indol-3-yl)-2-trityloxyiminopropanoic acid |
|---|---|
| PubChem CID | 71514449 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2E)-3-(1H-indol-3-yl)-2-trityloxyiminopropanoic acid |
| SMILES | O=C(O)/C(Cc1c[nH]c2ccccc12)=N/OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O3/c33-29(34)28(20-22-21-31-27-19-11-10-18-26(22)27)32-35-30(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-19,21,31H,20H2,(H,33,34)/b32-28+ |
| InChIKey | GCFIQKVDEBUVNY-VEWQFJOQSA-N |
| XLogP | 6.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|